cas: 163437-14-7 — see every product listed under this CAS number, including other names
(2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-(methylsulfonyl)butanoic acid, 98%, 98% (CAS 163437-14-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112U5C-250mg |
| cas | 163437-14-7 |
| size | 250mg |
| availability | 1500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 93.20 Pln | |
| Chemat | 5g | 155.60 Pln | |
| Chemat | 10g | 227.60 Pln | |
| Chemat | 25g | 448.40 Pln | |
| Chemat | 50g | 808.40 Pln | |
| Chemat | 100g | 1509.20 Pln | |
| Chemat | 250g | 3578.00 Pln | |
| Chemat | 500g | 6422.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid (CAS 163437-14-7) is a chemical compound with the molecular formula C20H21NO6S and a molecular weight of 403.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid. InChIKey: KJLKPACOHZKRFM-SFHVURJKSA-N.
| Molecular formula | C20H21NO6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid |
| InChIKey | KJLKPACOHZKRFM-SFHVURJKSA-N |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)