CAS 163437-14-7 appears in our catalog under these names: Fmoc–Met(O2)–OH, Fmoc-L-Met(O2)-OH, Fmoc-Met(O2)-OH 95%, (2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-4-(methylsulfonyl)butanoic acid, 98%, 98%, Fmoc-Met(O2)-OH, 97%. Offered by: GLPBio, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 1g, 10g, 100g, 250mg, 50g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid (CAS 163437-14-7) is a chemical compound with the molecular formula C20H21NO6S and a molecular weight of 403.5 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid. InChIKey: KJLKPACOHZKRFM-SFHVURJKSA-N.
| Molecular formula | C20H21NO6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylsulfonylbutanoic acid |
| InChIKey | KJLKPACOHZKRFM-SFHVURJKSA-N |
| SMILES | CS(=O)(=O)CC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)