CAS 253168-79-5 is the registry number for 2-(1-(3-Ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl)isoindoline-1,3-dione, 98%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione (CAS 253168-79-5) is a chemical compound with the molecular formula C20H21NO6S and a molecular weight of 403.5 g/mol. IUPAC name: 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione. InChIKey: LKEVYMKDZMOTIM-UHFFFAOYSA-N.
| Molecular formula | C20H21NO6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 2-[1-(3-ethoxy-4-methoxyphenyl)-2-methylsulfonylethyl]isoindole-1,3-dione |
| InChIKey | LKEVYMKDZMOTIM-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(CS(=O)(=O)C)N2C(=O)C3=CC=CC=C3C2=O)OC |
Computed by PubChem (NCBI)