cas: 18829-70-4 — see every product listed under this CAS number, including other names
(2S,3R)-2-(3,4-Dihydroxyphenyl)-3,4-dihydro-2H-1-benzopyran-3,5,7-triol, 98%, 98% (CAS 18829-70-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113GT1-10g |
| cas | 18829-70-4 |
| size | 10g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 5166.80 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 458.00 Pln | |
| Chemat | 1g | 1125.20 Pln | |
| Chemat | 5g | 3251.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(-)-catechin is the ()-enantiomer of catechin. It has a role as a metabolite. It is an enantiomer of a (+)-catechin.
Source: ChEBI
| Molecular formula | C15H14O6 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChIKey | PFTAWBLQPZVEMU-HIFRSBDPSA-N |
| SMILES | C1[C@H]([C@@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)