CAS 1261254-33-4 is the registry number for (+/-)-CATECHIN-2,3,4-13C3, 99 ATOM % 13&. Offered by: Sigma-Aldrich. Available pack sizes: 1MG, 5MG.
(2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (CAS 1261254-33-4) is a chemical compound with the molecular formula C15H14O6 and a molecular weight of 293.25 g/mol. IUPAC name: (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol. InChIKey: PFTAWBLQPZVEMU-QLZQUIFCSA-N.
| Molecular formula | C15H14O6 |
|---|---|
| Molecular weight | 293.25 g/mol |
| IUPAC name | (2S,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChIKey | PFTAWBLQPZVEMU-QLZQUIFCSA-N |
| SMILES | [13CH2]1[13C@H]([13C@@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)