Products 1217780-28-3
CAS 1217780-28-3 is the registry number for (±)-Epicatechin-13C3. Offered by: MedChemExpress. Available pack sizes: 5mg, 1mg.
(2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol (CAS 1217780-28-3) is a chemical compound with the molecular formula C15H14O6 and a molecular weight of 293.25 g/mol. IUPAC name: (2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol. InChIKey: PFTAWBLQPZVEMU-AVOAOITDSA-N.
| Molecular formula | C15H14O6 |
|---|---|
| Molecular weight | 293.25 g/mol |
| IUPAC name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
| InChIKey | PFTAWBLQPZVEMU-AVOAOITDSA-N |
| SMILES | [13CH2]1[13C@H]([13C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
Computed by PubChem (NCBI)