(2S,3R)-3-(tert-Butoxy)-1-[(9H-fluoren-9-ylmethoxy)carbonyl]pyrrolidine-2-carboxylic acid, 97%
cas: 443899-48-7 — see every product listed under this CAS number, including other names
(2S,3R)-3-(tert-Butoxy)-1-[(9H-fluoren-9-ylmethoxy)carbonyl]pyrrolidine-2-carboxylic acid, 97% (CAS 443899-48-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD00928541-25mg |
| cas | 443899-48-7 |
| size | 25mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 25mg | 808.63 Pln | |
| BLDpharm | 50mg | 1314.01 Pln | |
| BLDpharm | 100mg | 2174.81 Pln | |
| BLDpharm | 250mg | 3635.41 Pln | |
| BLDpharm | 1g | 9677.73 Pln | |
| Chemat | 25mg | 726.80 Pln | |
| Chemat | 50mg | 1192.40 Pln | |
| Chemat | 100mg | 1979.60 Pln | |
| Chemat | 250mg | 3318.80 Pln | |
| Chemat | 1g | 8858.00 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid (CAS 443899-48-7) is a chemical compound with the molecular formula C24H27NO5 and a molecular weight of 409.5 g/mol. IUPAC name: (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid. InChIKey: DTOQXZRPBAMOGM-RTWAWAEBSA-N.
| Molecular formula | C24H27NO5 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-[(2-methylpropan-2-yl)oxy]pyrrolidine-2-carboxylic acid |
| InChIKey | DTOQXZRPBAMOGM-RTWAWAEBSA-N |
| SMILES | CC(C)(C)O[C@@H]1CCN([C@@H]1C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)