Products 2061992-11-6
CAS 2061992-11-6 is the registry number for Sacubitril Impurity 44. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[(E,2R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pent-3-en-2-yl]amino]-4-oxobutanoic acid (CAS 2061992-11-6) is a chemical compound with the molecular formula C24H27NO5 and a molecular weight of 409.5 g/mol. IUPAC name: 4-[[(E,2R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pent-3-en-2-yl]amino]-4-oxobutanoic acid. InChIKey: MNTIZKOZNSZTCT-QGUORLBXSA-N.
| Molecular formula | C24H27NO5 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | 4-[[(E,2R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pent-3-en-2-yl]amino]-4-oxobutanoic acid |
| InChIKey | MNTIZKOZNSZTCT-QGUORLBXSA-N |
| SMILES | CCOC(=O)/C(=C/[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O)/C |
Computed by PubChem (NCBI)
Synonyms:
Sacubitril Impurity 54