CAS 2751722-77-5 appears in our catalog under these names: Sacubitril Impurity 32, (E)-Sacubitril Maleic Acid, >95% (HPLC), (Z)-4-(((2S,4R)-1-([1,1'-Biphenyl]-4-yl)-5-ethoxy-4-methyl-5-oxopentan-2-yl)amino)-4-oxobut-2-enoic acid, 96%, 96%, (Z)2S,4R-Sacubitril, 96.89%, (Z)2S,4R-Sacubitril (Standard). Offered by: Chemat Brand, TRC, Chemat, MedChemExpress. Available pack sizes: on request, 100mg, 10mg, 50mg, 1mg, 5mg, 5 mg, 10 mg.
(Z)-4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobut-2-enoic acid (CAS 2751722-77-5) is a chemical compound with the molecular formula C24H27NO5 and a molecular weight of 409.5 g/mol. IUPAC name: (Z)-4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobut-2-enoic acid. InChIKey: OBIKFELFUFDHLD-JLMIGJNSSA-N.
| Molecular formula | C24H27NO5 |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (Z)-4-[[(2S,4R)-5-ethoxy-4-methyl-5-oxo-1-(4-phenylphenyl)pentan-2-yl]amino]-4-oxobut-2-enoic acid |
| InChIKey | OBIKFELFUFDHLD-JLMIGJNSSA-N |
| SMILES | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)/C=C\C(=O)O |
Computed by PubChem (NCBI)