Products 203645-44-7

CAS 203645-44-7 is the registry number for 2-Benzyl 1-(tert-butyl) (2S,4R)-4-benzyl-5-oxopyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-O-benzyl 1-O-tert-butyl (2S,4R)-4-benzyl-5-oxopyrrolidine-1,2-dicarboxylate (CAS 203645-44-7) is a chemical compound with the molecular formula C24H27NO5 and a molecular weight of 409.5 g/mol. IUPAC name: 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-benzyl-5-oxopyrrolidine-1,2-dicarboxylate. InChIKey: LMILJTUPJYRGKN-UXHICEINSA-N.

Identity
Molecular formulaC24H27NO5
Molecular weight409.5 g/mol
IUPAC name2-O-benzyl 1-O-tert-butyl (2S,4R)-4-benzyl-5-oxopyrrolidine-1,2-dicarboxylate
InChIKeyLMILJTUPJYRGKN-UXHICEINSA-N
SMILESCC(C)(C)OC(=O)N1[C@@H](C[C@H](C1=O)CC2=CC=CC=C2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)