cas: 1825-00-9 — see every product listed under this CAS number, including other names
(2S,3R,4S,5S)-2-Methoxytetrahydro-2H-pyran-3,4,5-triol 97% (CAS 1825-00-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A371958-1g |
| cas | 1825-00-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 776.44 Pln | |
| Ambeed | 25g | 2478.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A371958 |
(2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol (CAS 1825-00-9) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-AZGQCCRYSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-AZGQCCRYSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@H](CO1)O)O)O |
Computed by PubChem (NCBI)