cas: 1825-00-9 — see every product listed under this CAS number, including other names
(2S,3R,4S,5S)-2-Methoxytetrahydro-2H-pyran-3,4,5-triol, 97%, 97% (CAS 1825-00-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1134Y3-100mg |
| cas | 1825-00-9 |
| size | 100mg |
| availability | 34g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 458.00 Pln | |
| Chemat | 25g | 1970.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol (CAS 1825-00-9) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-AZGQCCRYSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-AZGQCCRYSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@H](CO1)O)O)O |
Computed by PubChem (NCBI)