cas: 80082-65-1 — see every product listed under this CAS number, including other names
(2S,3S)-3-Amino-2-methyl-4-oxoazetidine-1-sulfonic acid 97% (CAS 80082-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A114393-1g |
| cas | 80082-65-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 147.88 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1716.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A114393 |
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid (CAS 80082-65-1) is a chemical compound with the molecular formula C4H8N2O4S and a molecular weight of 180.19 g/mol. IUPAC name: (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid. InChIKey: ISUIVWNWEDIHJD-HRFVKAFMSA-N.
| Molecular formula | C4H8N2O4S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid |
| InChIKey | ISUIVWNWEDIHJD-HRFVKAFMSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1S(=O)(=O)O)N |
Computed by PubChem (NCBI)