CAS 80082-65-1 appears in our catalog under these names: (2S,3S)-3-Amino-2-methyl-4-oxoazetidine-1-sulfonic acid, 96%, Aztreonam Impurity 16, (2S,3S)-3-Amino-2-methyl-4-oxoazetidine-1-sulphonic Acid, >95% (HPLC), (2S,3S)–3–Amino–2–methyl–4–oxoazetidine–1–sulfonic acid, (2S,3S)-3-Amino-2-methyl-4-oxoazetidine-1-sulfonic acid 97%. Offered by: Combi-blocks, Chemat Brand, TRC, GLPBio, Ambeed. Available pack sizes: 100g, 25g, 500g, 5g, on request, 10g, 1g.
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid (CAS 80082-65-1) is a chemical compound with the molecular formula C4H8N2O4S and a molecular weight of 180.19 g/mol. IUPAC name: (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid. InChIKey: ISUIVWNWEDIHJD-HRFVKAFMSA-N.
| Molecular formula | C4H8N2O4S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid |
| InChIKey | ISUIVWNWEDIHJD-HRFVKAFMSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1S(=O)(=O)O)N |
Computed by PubChem (NCBI)