cas: 80082-65-1 — see every product listed under this CAS number, including other names
(2S,3S)-3-Amino-2-methyl-4-oxo-1-azetidinesulfonic acid, 95% (CAS 80082-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034758-1G |
| cas | 80082-65-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 122.89 Pln | |
| Fluorochem | 25g | 138.51 Pln | |
| Fluorochem | 100g | 388.42 Pln | |
| Fluorochem | 500g | 1705.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid (CAS 80082-65-1) is a chemical compound with the molecular formula C4H8N2O4S and a molecular weight of 180.19 g/mol. IUPAC name: (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid. InChIKey: ISUIVWNWEDIHJD-HRFVKAFMSA-N.
| Molecular formula | C4H8N2O4S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid |
| InChIKey | ISUIVWNWEDIHJD-HRFVKAFMSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1S(=O)(=O)O)N |
Computed by PubChem (NCBI)