cas: 80082-65-1 — see every product listed under this CAS number, including other names
(2S,3S)-3-Amino-2-Methyl-4-Oxoazetidine-1-Sulfonic Acid, 97%, 97% (CAS 80082-65-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116DC8-1g |
| cas | 80082-65-1 |
| size | 1g |
| availability | 200g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 88.40 Pln | |
| Chemat | 25g | 122.00 Pln | |
| Chemat | 100g | 299.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid (CAS 80082-65-1) is a chemical compound with the molecular formula C4H8N2O4S and a molecular weight of 180.19 g/mol. IUPAC name: (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid. InChIKey: ISUIVWNWEDIHJD-HRFVKAFMSA-N.
| Molecular formula | C4H8N2O4S |
|---|---|
| Molecular weight | 180.19 g/mol |
| IUPAC name | (2S,3S)-3-amino-2-methyl-4-oxoazetidine-1-sulfonic acid |
| InChIKey | ISUIVWNWEDIHJD-HRFVKAFMSA-N |
| SMILES | C[C@H]1[C@@H](C(=O)N1S(=O)(=O)O)N |
Computed by PubChem (NCBI)