cas: 69880-85-9 — see every product listed under this CAS number, including other names
(2S,3S,4S,5R)-3-Amino-2,4,5,6-tetrahydroxyhexanal hydrochloride, ≥98%, ≥98% (CAS 69880-85-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FDE5-25mg |
| cas | 69880-85-9 |
| size | 25mg |
| availability | 0.05g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 467.60 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
(2S,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal;hydrochloride (CAS 69880-85-9) is a chemical compound with the molecular formula C6H14ClNO5 and a molecular weight of 215.63 g/mol. IUPAC name: (2S,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal;hydrochloride. InChIKey: ADFOMBKCPIMCOO-MVNLRXSJSA-N.
| Molecular formula | C6H14ClNO5 |
|---|---|
| Molecular weight | 215.63 g/mol |
| IUPAC name | (2S,3S,4S,5R)-3-amino-2,4,5,6-tetrahydroxyhexanal;hydrochloride |
| InChIKey | ADFOMBKCPIMCOO-MVNLRXSJSA-N |
| SMILES | C([C@H]([C@H]([C@@H]([C@@H](C=O)O)N)O)O)O.Cl |
Computed by PubChem (NCBI)