cas: 1049981-50-1 — see every product listed under this CAS number, including other names
(2S,4R)-4-(2-(TRIFLUOROMETHYL)BENZYL)PYRROLIDINE-2-CARBOXYLIC ACID, 96%, 96% (CAS 1049981-50-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1105XE-100mg |
| cas | 1049981-50-1 |
| size | 100mg |
| availability | 0.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1154.00 Pln | |
| Chemat | 250mg | 2085.20 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid (CAS 1049981-50-1) is a chemical compound with the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. IUPAC name: (2S,4R)-4-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid. InChIKey: MCVCNZBZJWWNLR-KCJUWKMLSA-N.
| Molecular formula | C13H14F3NO2 |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | (2S,4R)-4-[[2-(trifluoromethyl)phenyl]methyl]pyrrolidine-2-carboxylic acid |
| InChIKey | MCVCNZBZJWWNLR-KCJUWKMLSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)CC2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)