CAS 170804-10-1 is the registry number for Ethyl (Z)-3-(benzylamino)-4,4,4-trifluorobut-2-enoate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (Z)-3-(benzylamino)-4,4,4-trifluorobut-2-enoate (CAS 170804-10-1) is a chemical compound with the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. IUPAC name: ethyl (Z)-3-(benzylamino)-4,4,4-trifluorobut-2-enoate. InChIKey: GBHULWMFABYDDB-FLIBITNWSA-N.
| Molecular formula | C13H14F3NO2 |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | ethyl (Z)-3-(benzylamino)-4,4,4-trifluorobut-2-enoate |
| InChIKey | GBHULWMFABYDDB-FLIBITNWSA-N |
| SMILES | CCOC(=O)/C=C(/C(F)(F)F)\NCC1=CC=CC=C1 |
Computed by PubChem (NCBI)