Products 677704-60-8

CAS 677704-60-8 is the registry number for 4-Piperidin-1-yl-3-(trifluoromethyl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-piperidin-1-yl-3-(trifluoromethyl)benzoic acid (CAS 677704-60-8) is a chemical compound with the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. IUPAC name: 4-piperidin-1-yl-3-(trifluoromethyl)benzoic acid. InChIKey: HAHBSQIQOLCLBF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14F3NO2
Molecular weight273.25 g/mol
IUPAC name4-piperidin-1-yl-3-(trifluoromethyl)benzoic acid
InChIKeyHAHBSQIQOLCLBF-UHFFFAOYSA-N
SMILESC1CCN(CC1)C2=C(C=C(C=C2)C(=O)O)C(F)(F)F

Computed by PubChem (NCBI)