CAS 2241052-68-4 is the registry number for Ethyl 3-[4-(trifluoromethyl)-2-pyridinyl]cyclobutanecarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
Ethyl 3-[4-(trifluoromethyl)-2-pyridinyl]cyclobutane-1-carboxylate (CAS 2241052-68-4) is a chemical compound with the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. IUPAC name: ethyl 3-[4-(trifluoromethyl)-2-pyridinyl]cyclobutane-1-carboxylate. InChIKey: NHPFHZZOQVEBDM-UHFFFAOYSA-N.
| Molecular formula | C13H14F3NO2 |
|---|---|
| Molecular weight | 273.25 g/mol |
| IUPAC name | ethyl 3-[4-(trifluoromethyl)-2-pyridinyl]cyclobutane-1-carboxylate |
| InChIKey | NHPFHZZOQVEBDM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC(C1)C2=NC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)