cas: 473806-21-2 — see every product listed under this CAS number, including other names
(2S,4R)-Methyl 4-(tert-butoxycarbonylamino)pyrrolidine-2-carboxylate, 95%, 95% (CAS 473806-21-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DBPK-5g |
| cas | 473806-21-2 |
| size | 5g |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 4499.60 Pln | |
| Chemat | 50mg | 165.20 Pln | |
| Chemat | 100mg | 227.60 Pln | |
| Chemat | 250mg | 376.40 Pln | |
| Chemat | 1g | 1326.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate (CAS 473806-21-2) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate. InChIKey: QOJVDTYOYUAFQA-SFYZADRCSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | methyl (2S,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate |
| InChIKey | QOJVDTYOYUAFQA-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](NC1)C(=O)OC |
Computed by PubChem (NCBI)