CAS 1279200-56-4 is the registry number for (2R,4R)-Methyl 4-((tert-butoxycarbonyl)amino)pyrrolidine-2-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate (CAS 1279200-56-4) is a chemical compound with the molecular formula C11H20N2O4 and a molecular weight of 244.29 g/mol. IUPAC name: methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate. InChIKey: QOJVDTYOYUAFQA-HTQZYQBOSA-N.
| Molecular formula | C11H20N2O4 |
|---|---|
| Molecular weight | 244.29 g/mol |
| IUPAC name | methyl (2R,4R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylate |
| InChIKey | QOJVDTYOYUAFQA-HTQZYQBOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@@H](NC1)C(=O)OC |
Computed by PubChem (NCBI)