cas: 394734-77-1 — see every product listed under this CAS number, including other names
(2S,4S)-1-(tert-Butoxycarbonyl)-4-cyclohexylpyrrolidine-2-carboxylic acid, 97%, 97% (CAS 394734-77-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CAAM-100mg |
| cas | 394734-77-1 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1907.60 Pln | |
| Chemat | 250mg | 3750.80 Pln | |
| Chemat | 500mg | 5598.80 Pln | |
| Chemat | 1g | 9285.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S,4S)-4-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 394734-77-1) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: (2S,4S)-4-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: PVYGHRWCXWTYGS-OLZOCXBDSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | (2S,4S)-4-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | PVYGHRWCXWTYGS-OLZOCXBDSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)C2CCCCC2 |
Computed by PubChem (NCBI)