CAS 1391732-45-8 appears in our catalog under these names: 8-tert-Butyl 2-methyl 8-azaspiro[4.5]decane-2,8-dicarboxylate, 95%, 8-tert-Butyl 2-methyl 8-azaspiro(4.5)decane-2,8-dicarboxylate, 98+%, 8–tert–Butyl 2–methyl 8–azaspiro(4·5)decane–2,8–dicarboxylate, 8-(tert-Butyl) 2-methyl 8-azaspiro[4.5]decane-2,8-dicarboxylate, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 500mg.
8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate (CAS 1391732-45-8) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate. InChIKey: MTIWDIYQTBHBSX-UHFFFAOYSA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | 8-O-tert-butyl 3-O-methyl 8-azaspiro[4.5]decane-3,8-dicarboxylate |
| InChIKey | MTIWDIYQTBHBSX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCC(C2)C(=O)OC)CC1 |
Computed by PubChem (NCBI)