Products 2010955-43-6

CAS 2010955-43-6 is the registry number for 2-Allyl-1-Boc-pipecolic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 2-O-ethyl 2-prop-2-enylpiperidine-1,2-dicarboxylate (CAS 2010955-43-6) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: 1-O-tert-butyl 2-O-ethyl 2-prop-2-enylpiperidine-1,2-dicarboxylate. InChIKey: CIJLMTWZPMPZHX-UHFFFAOYSA-N.

Identity
Molecular formulaC16H27NO4
Molecular weight297.39 g/mol
IUPAC name1-O-tert-butyl 2-O-ethyl 2-prop-2-enylpiperidine-1,2-dicarboxylate
InChIKeyCIJLMTWZPMPZHX-UHFFFAOYSA-N
SMILESCCOC(=O)C1(CCCCN1C(=O)OC(C)(C)C)CC=C

Computed by PubChem (NCBI)