CAS 934470-83-4 is the registry number for (2S,4R)-Boc-4-cyclohexyl-pyrrolidine-2-carboxylic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
(2S,4R)-4-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 934470-83-4) is a chemical compound with the molecular formula C16H27NO4 and a molecular weight of 297.39 g/mol. IUPAC name: (2S,4R)-4-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: PVYGHRWCXWTYGS-STQMWFEESA-N.
| Molecular formula | C16H27NO4 |
|---|---|
| Molecular weight | 297.39 g/mol |
| IUPAC name | (2S,4R)-4-cyclohexyl-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | PVYGHRWCXWTYGS-STQMWFEESA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)C2CCCCC2 |
Computed by PubChem (NCBI)