cas: 773872-61-0 — see every product listed under this CAS number, including other names
(3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)methanol 95% (CAS 773872-61-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A314557-100mg |
| cas | 773872-61-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 592.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A314557 |
[3-[3-(trifluoromethyl)phenyl]phenyl]methanol (CAS 773872-61-0) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: [3-[3-(trifluoromethyl)phenyl]phenyl]methanol. InChIKey: IROMTEIILLDKHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | [3-[3-(trifluoromethyl)phenyl]phenyl]methanol |
| InChIKey | IROMTEIILLDKHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(F)(F)F)CO |
Computed by PubChem (NCBI)