Products 1214380-79-6
CAS 1214380-79-6 appears in our catalog under these names: 2-Methoxy-5-(trifluoromethyl)biphenyl, 95%, 2-Methoxy-5-(trifluoromethyl)-1,1'-biphenyl, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100g, 25g, 5g, 1g.
1-methoxy-2-phenyl-4-(trifluoromethyl)benzene (CAS 1214380-79-6) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: 1-methoxy-2-phenyl-4-(trifluoromethyl)benzene. InChIKey: LSGPOVAWFIOWBF-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | 1-methoxy-2-phenyl-4-(trifluoromethyl)benzene |
| InChIKey | LSGPOVAWFIOWBF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(F)(F)F)C2=CC=CC=C2 |
Computed by PubChem (NCBI)