CAS 773872-63-2 is the registry number for [3'-(Trifluoromethyl)[1,1'-biphenyl]-4-yl]methanol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[4-[3-(trifluoromethyl)phenyl]phenyl]methanol (CAS 773872-63-2) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: [4-[3-(trifluoromethyl)phenyl]phenyl]methanol. InChIKey: BVPHVFJGWWPIEY-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | [4-[3-(trifluoromethyl)phenyl]phenyl]methanol |
| InChIKey | BVPHVFJGWWPIEY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)