CAS 773872-61-0 appears in our catalog under these names: (3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)methanol, 95%, (3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)methanol 95%, (3'-(Trifluoromethyl)-[1,1'-biphenyl]-3-yl)methanol, 95%, 95%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg.
[3-[3-(trifluoromethyl)phenyl]phenyl]methanol (CAS 773872-61-0) is a chemical compound with the molecular formula C14H11F3O and a molecular weight of 252.23 g/mol. IUPAC name: [3-[3-(trifluoromethyl)phenyl]phenyl]methanol. InChIKey: IROMTEIILLDKHZ-UHFFFAOYSA-N.
| Molecular formula | C14H11F3O |
|---|---|
| Molecular weight | 252.23 g/mol |
| IUPAC name | [3-[3-(trifluoromethyl)phenyl]phenyl]methanol |
| InChIKey | IROMTEIILLDKHZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C2=CC(=CC=C2)C(F)(F)F)CO |
Computed by PubChem (NCBI)