cas: 773873-05-5 — see every product listed under this CAS number, including other names
(3'-Fluoro[1,1'-biphenyl]-4-yl)methanol, 95% (CAS 773873-05-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041774-50MG |
| cas | 773873-05-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 1096.51 Pln | |
| Fluorochem | 100mg | 1913.93 Pln | |
| Fluorochem | 250mg | 3569.59 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(3-fluorophenyl)phenyl]methanol (CAS 773873-05-5) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: [4-(3-fluorophenyl)phenyl]methanol. InChIKey: OSBNEOSMNIVQEN-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | [4-(3-fluorophenyl)phenyl]methanol |
| InChIKey | OSBNEOSMNIVQEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)