CAS 773873-05-5 appears in our catalog under these names: (3'-Fluoro-[1,1'-biphenyl]-4-yl)methanol, 96%, (3'-Fluoro-[1,1'-biphenyl]-4-yl)methanol, 95%, 95%, (3'-Fluoro[1,1'-biphenyl]-4-yl)methanol, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 1g, 5g, 50mg, 100mg.
[4-(3-fluorophenyl)phenyl]methanol (CAS 773873-05-5) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: [4-(3-fluorophenyl)phenyl]methanol. InChIKey: OSBNEOSMNIVQEN-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | [4-(3-fluorophenyl)phenyl]methanol |
| InChIKey | OSBNEOSMNIVQEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)