Products 450-39-5
CAS 450-39-5 appears in our catalog under these names: 4-Fluoro-4'-methoxybiphenyl, 95%, 4-Fluoro-4'-methoxybiphenyl, 4-Fluoro-4'-methoxy-1,1'-biphenyl 98%, 4-Fluoro-4'-methoxy-1,1'-biphenyl, 98%, 98%, 4-Fluoro-4'-methoxybiphenyl, 96%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 0,25g, 0,1g, 0,5g.
1-fluoro-4-(4-methoxyphenyl)benzene (CAS 450-39-5) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: 1-fluoro-4-(4-methoxyphenyl)benzene. InChIKey: HPHJIGXCDCZLTP-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | 1-fluoro-4-(4-methoxyphenyl)benzene |
| InChIKey | HPHJIGXCDCZLTP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)