CAS 147497-56-1 appears in our catalog under these names: 4-(4-Fluorophenyl)benzyl alcohol, 98%, (4'-Fluoro[1,1'-biphenyl]-4-yl)methanol, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 500mg.
[4-(4-fluorophenyl)phenyl]methanol (CAS 147497-56-1) is a chemical compound with the molecular formula C13H11FO and a molecular weight of 202.22 g/mol. IUPAC name: [4-(4-fluorophenyl)phenyl]methanol. InChIKey: ZSWIVXLMMVNSCM-UHFFFAOYSA-N.
| Molecular formula | C13H11FO |
|---|---|
| Molecular weight | 202.22 g/mol |
| IUPAC name | [4-(4-fluorophenyl)phenyl]methanol |
| InChIKey | ZSWIVXLMMVNSCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)