cas: 140235-26-3 — see every product listed under this CAS number, including other names
(3,4-DIFLUORO-PHENYL)-PIPERIDIN-4-YL-METHANONE HCL, 97% (CAS 140235-26-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300999-250MG |
| cas | 140235-26-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 378.01 Pln | |
| Fluorochem | 1g | 549.82 Pln | |
| Fluorochem | 2.5g | 1289.15 Pln | |
| Fluorochem | 5g | 2231.52 Pln | |
| Fluorochem | 10g | 3845.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 140235-26-3) is a chemical compound with the molecular formula C12H14ClF2NO and a molecular weight of 261.69 g/mol. IUPAC name: (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: IPNJNEPAHFKDLB-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO |
|---|---|
| Molecular weight | 261.69 g/mol |
| IUPAC name | (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | IPNJNEPAHFKDLB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)