cas: 140235-26-3 — see every product listed under this CAS number, including other names
(3,4-Difluorophenyl)(piperidin-4-yl)methanone hydrochloride, 97% (CAS 140235-26-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A206126-250mg |
| cas | 140235-26-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 584.29 Pln | |
| AmBeed | 5g | 3565.87 Pln | |
| AmBeed | 10g | 6163.36 Pln | |
| AmBeed | 25g | 10902.64 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 140235-26-3) is a chemical compound with the molecular formula C12H14ClF2NO and a molecular weight of 261.69 g/mol. IUPAC name: (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: IPNJNEPAHFKDLB-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO |
|---|---|
| Molecular weight | 261.69 g/mol |
| IUPAC name | (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | IPNJNEPAHFKDLB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)