cas: 140235-26-3 — see every product listed under this CAS number, including other names
(3,4-Difluoro-phenyl)-piperidin-4-yl-methanone, HCl, 97%, 97% (CAS 140235-26-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112C7U-100mg |
| cas | 140235-26-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 203.60 Pln | |
| Chemat | 250mg | 309.20 Pln | |
| Chemat | 1g | 597.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride (CAS 140235-26-3) is a chemical compound with the molecular formula C12H14ClF2NO and a molecular weight of 261.69 g/mol. IUPAC name: (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride. InChIKey: IPNJNEPAHFKDLB-UHFFFAOYSA-N.
| Molecular formula | C12H14ClF2NO |
|---|---|
| Molecular weight | 261.69 g/mol |
| IUPAC name | (3,4-difluorophenyl)-piperidin-4-ylmethanone;hydrochloride |
| InChIKey | IPNJNEPAHFKDLB-UHFFFAOYSA-N |
| SMILES | C1CNCCC1C(=O)C2=CC(=C(C=C2)F)F.Cl |
Computed by PubChem (NCBI)