cas: 1218790-61-4 — see every product listed under this CAS number, including other names
(3,5-Dichloro-4-propoxyphenyl)boronic acid (CAS 1218790-61-4) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219060-5G |
| cas | 1218790-61-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1549.47 Pln |
| delivery time | 3-4 weeks |
|---|
(3,5-dichloro-4-propoxyphenyl)boronic acid (CAS 1218790-61-4) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (3,5-dichloro-4-propoxyphenyl)boronic acid. InChIKey: GXOBEFMWCPTAAN-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (3,5-dichloro-4-propoxyphenyl)boronic acid |
| InChIKey | GXOBEFMWCPTAAN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OCCC)Cl)(O)O |
Computed by PubChem (NCBI)