Products 2096331-41-6

CAS 2096331-41-6 is the registry number for 2,3-Dichloro-4-propoxyphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g.

Structural formula: {0} (CAS {1})

(2,3-dichloro-4-propoxyphenyl)boronic acid (CAS 2096331-41-6) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (2,3-dichloro-4-propoxyphenyl)boronic acid. InChIKey: VOHPWLJZKVUWHQ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BCl2O3
Molecular weight248.90 g/mol
IUPAC name(2,3-dichloro-4-propoxyphenyl)boronic acid
InChIKeyVOHPWLJZKVUWHQ-UHFFFAOYSA-N
SMILESB(C1=C(C(=C(C=C1)OCCC)Cl)Cl)(O)O

Computed by PubChem (NCBI)