CAS 1218790-62-5 appears in our catalog under these names: 3,5-Dichloro-4-isopropoxyphenylboronic acid, 97%, (3,5-Dichloro-4-isopropoxyphenyl)boronic acid 97%, 3,5-Dichloro-4-isopropoxyphenylboronic acid, 97%, 97%, (3,5-Dichloro-4-isopropoxyphenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.
(3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid (CAS 1218790-62-5) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: OTEROWRZDFNANP-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid |
| InChIKey | OTEROWRZDFNANP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)Cl)OC(C)C)Cl)(O)O |
Computed by PubChem (NCBI)