Products 1218790-62-5

CAS 1218790-62-5 appears in our catalog under these names: 3,5-Dichloro-4-isopropoxyphenylboronic acid, 97%, (3,5-Dichloro-4-isopropoxyphenyl)boronic acid 97%, 3,5-Dichloro-4-isopropoxyphenylboronic acid, 97%, 97%, (3,5-Dichloro-4-isopropoxyphenyl)boronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid (CAS 1218790-62-5) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid. InChIKey: OTEROWRZDFNANP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11BCl2O3
Molecular weight248.90 g/mol
IUPAC name(3,5-dichloro-4-propan-2-yloxyphenyl)boronic acid
InChIKeyOTEROWRZDFNANP-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C(=C1)Cl)OC(C)C)Cl)(O)O

Computed by PubChem (NCBI)