CAS 325786-18-3 is the registry number for 2,4-Dichloro-5-isopropoxyphenylboronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2,4-dichloro-5-propan-2-yloxyphenyl)boronic acid (CAS 325786-18-3) is a chemical compound with the molecular formula C9H11BCl2O3 and a molecular weight of 248.90 g/mol. IUPAC name: (2,4-dichloro-5-propan-2-yloxyphenyl)boronic acid. InChIKey: OMFHFEFPEHEGLG-UHFFFAOYSA-N.
| Molecular formula | C9H11BCl2O3 |
|---|---|
| Molecular weight | 248.90 g/mol |
| IUPAC name | (2,4-dichloro-5-propan-2-yloxyphenyl)boronic acid |
| InChIKey | OMFHFEFPEHEGLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)Cl)OC(C)C)(O)O |
Computed by PubChem (NCBI)