cas: 879896-52-3 — see every product listed under this CAS number, including other names
(3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)methanamine hydrochloride, 97% (CAS 879896-52-3) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A728191-5g |
| cas | 879896-52-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9210.04 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(3,5-dimethyl-1-phenylpyrazol-4-yl)methanamine (CAS 879896-52-3) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: (3,5-dimethyl-1-phenylpyrazol-4-yl)methanamine. InChIKey: OBCGZRPPRQGJNF-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | (3,5-dimethyl-1-phenylpyrazol-4-yl)methanamine |
| InChIKey | OBCGZRPPRQGJNF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2=CC=CC=C2)C)CN |
Computed by PubChem (NCBI)