Products 956198-18-8
CAS 956198-18-8 appears in our catalog under these names: 1-(2,4-Dimethylphenyl)-3-methyl-1h-pyrazol-5-amine, 95%, 1-(2,4-Dimethylphenyl)-3-methyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-(2,4-dimethylphenyl)-5-methylpyrazol-3-amine (CAS 956198-18-8) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: 2-(2,4-dimethylphenyl)-5-methylpyrazol-3-amine. InChIKey: SUVJXCVTYXQWDZ-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | 2-(2,4-dimethylphenyl)-5-methylpyrazol-3-amine |
| InChIKey | SUVJXCVTYXQWDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N2C(=CC(=N2)C)N)C |
Computed by PubChem (NCBI)