Products 879896-52-3

CAS 879896-52-3 appears in our catalog under these names: (3,5-Dimethyl-1-phenyl-1h-pyrazol-4-yl)methylamine hydrochloride, 95%, (3,5-Dimethyl-1-phenyl-1H-pyrazol-4-yl)methanamine hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

(3,5-dimethyl-1-phenylpyrazol-4-yl)methanamine (CAS 879896-52-3) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: (3,5-dimethyl-1-phenylpyrazol-4-yl)methanamine. InChIKey: OBCGZRPPRQGJNF-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15N3
Molecular weight201.27 g/mol
IUPAC name(3,5-dimethyl-1-phenylpyrazol-4-yl)methanamine
InChIKeyOBCGZRPPRQGJNF-UHFFFAOYSA-N
SMILESCC1=C(C(=NN1C2=CC=CC=C2)C)CN

Computed by PubChem (NCBI)