Products 827614-44-8
CAS 827614-44-8 appears in our catalog under these names: 3-Isopropyl-1-phenyl-1h-pyrazol-5-amine, 95%, 3-Isopropyl-1-phenyl-1H-pyrazol-5-amine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 1g, 5g.
1-phenyl-3-propan-2-ylpyrazol-5-amine (CAS 827614-44-8) is a chemical compound with the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. IUPAC name: 1-phenyl-3-propan-2-ylpyrazol-5-amine. InChIKey: RZIRPJOVBWGTDI-UHFFFAOYSA-N.
| Molecular formula | C12H15N3 |
|---|---|
| Molecular weight | 201.27 g/mol |
| IUPAC name | 1-phenyl-3-propan-2-ylpyrazol-5-amine |
| InChIKey | RZIRPJOVBWGTDI-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NN(C(=C1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)