CAS 850568-81-9 appears in our catalog under these names: 3-BOC-amino-4-methylphenylboronic acid, 97%, 97%, (3-((tert-Butoxycarbonyl)amino)-4-methylphenyl)boronic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
[4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 850568-81-9) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: RUPLVISWFCBMCR-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | RUPLVISWFCBMCR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)