CAS 489446-42-6 appears in our catalog under these names: 4-(N-Boc-aminomethyl)phenylboronic acid, 95%, (4–(((tert–Butoxycarbonyl)amino)methyl)phenyl)boronic acid, 4-(Boc-aminomethyl)benzeneboronic acid, 95% , (4-(((tert-Butoxycarbonyl)amino)methyl)phenyl)boronic acid, 95%, 95%, (4-(((tert-Butoxycarbonyl)amino)methyl)phenyl)boronic acid, 98.75%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), Chemat, MedChemExpress. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 100mg, 50g, 100g.
[4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid (CAS 489446-42-6) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid. InChIKey: MUBGEKQUCSEECZ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]phenyl]boronic acid |
| InChIKey | MUBGEKQUCSEECZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)