Products 2096333-56-9
CAS 2096333-56-9 is the registry number for 2-(tert-Butylcarbamoyl)-5-methoxyphenylboronic acid, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[2-(tert-butylcarbamoyl)-5-methoxyphenyl]boronic acid (CAS 2096333-56-9) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [2-(tert-butylcarbamoyl)-5-methoxyphenyl]boronic acid. InChIKey: FKRGUEMYOYTQRO-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [2-(tert-butylcarbamoyl)-5-methoxyphenyl]boronic acid |
| InChIKey | FKRGUEMYOYTQRO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)OC)C(=O)NC(C)(C)C)(O)O |
Computed by PubChem (NCBI)