CAS 913835-34-4 appears in our catalog under these names: [4-(Diethylcarbamoyl)-2-methoxy]phenylboronic acid, 98%, (4-(Diethylcarbamoyl)-2-methoxyphenyl)boronic acid, 98%, (4-(Diethylcarbamoyl)-2-methoxyphenyl)boronic acid, 97%, [4-(Diethylcarbamoyl)-2-Methoxy]Phenylboronic Acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g.
[4-(diethylcarbamoyl)-2-methoxyphenyl]boronic acid (CAS 913835-34-4) is a chemical compound with the molecular formula C12H18BNO4 and a molecular weight of 251.09 g/mol. IUPAC name: [4-(diethylcarbamoyl)-2-methoxyphenyl]boronic acid. InChIKey: VKKSSTUUJZQAQY-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4 |
|---|---|
| Molecular weight | 251.09 g/mol |
| IUPAC name | [4-(diethylcarbamoyl)-2-methoxyphenyl]boronic acid |
| InChIKey | VKKSSTUUJZQAQY-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)C(=O)N(CC)CC)OC)(O)O |
Computed by PubChem (NCBI)